C13H21BrN2O3S — CID 114380334
3-amino-5-bromo-2-methyl-N-[2-(2-methylpropoxy)ethyl]benzenesulfonamide (PubChem CID 114380334) has the molecular formula C13H21BrN2O3S and a molecular weight of 365.29 g/mol. Its IUPAC name is 3-amino-5-bromo-2-methyl-N-[2-(2-methylpropoxy)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-5-bromo-2-methyl-N-[2-(2-methylpropoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 114380334 |
| Molecular Formula | C13H21BrN2O3S |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 3-amino-5-bromo-2-methyl-N-[2-(2-methylpropoxy)ethyl]benzenesulfonamide |
| SMILES | Cc1c(N)cc(Br)cc1S(=O)(=O)NCCOCC(C)C |
| InChI | InChI=1S/C13H21BrN2O3S/c1-9(2)8-19-5-4-16-20(17,18)13-7-11(14)6-12(15)10(13)3/h6-7,9,16H,4-5,8,15H2,1-3H3 |
| InChIKey | XTIVANZULWKXFA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|