C12H22N2O3S2 — CID 106085403
5-(aminomethyl)-2-methyl-N-[2-(2-methylpropoxy)ethyl]thiophene-3-sulfonamide (PubChem CID 106085403) has the molecular formula C12H22N2O3S2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 5-(aminomethyl)-2-methyl-N-[2-(2-methylpropoxy)ethyl]thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-methyl-N-[2-(2-methylpropoxy)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106085403 |
| Molecular Formula | C12H22N2O3S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 5-(aminomethyl)-2-methyl-N-[2-(2-methylpropoxy)ethyl]thiophene-3-sulfonamide |
| SMILES | Cc1sc(CN)cc1S(=O)(=O)NCCOCC(C)C |
| InChI | InChI=1S/C12H22N2O3S2/c1-9(2)8-17-5-4-14-19(15,16)12-6-11(7-13)18-10(12)3/h6,9,14H,4-5,7-8,13H2,1-3H3 |
| InChIKey | HUVRWKNNHPTTCI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|