C10H15N5O2S2 — CID 106077262
5-(aminomethyl)-2-methyl-N-[2-(triazol-1-yl)ethyl]thiophene-3-sulfonamide (PubChem CID 106077262) has the molecular formula C10H15N5O2S2 and a molecular weight of 301.40 g/mol. Its IUPAC name is 5-(aminomethyl)-2-methyl-N-[2-(triazol-1-yl)ethyl]thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-methyl-N-[2-(triazol-1-yl)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106077262 |
| Molecular Formula | C10H15N5O2S2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-(aminomethyl)-2-methyl-N-[2-(triazol-1-yl)ethyl]thiophene-3-sulfonamide |
| SMILES | Cc1sc(CN)cc1S(=O)(=O)NCCn1ccnn1 |
| InChI | InChI=1S/C10H15N5O2S2/c1-8-10(6-9(7-11)18-8)19(16,17)13-3-5-15-4-2-12-14-15/h2,4,6,13H,3,5,7,11H2,1H3 |
| InChIKey | AFIQKWCKXAINGL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |