C9H12N6O2S — CID 113413216
4-amino-N-[2-(triazol-1-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 113413216) has the molecular formula C9H12N6O2S and a molecular weight of 268.30 g/mol. Its IUPAC name is 4-amino-N-[2-(triazol-1-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 4-amino-N-[2-(triazol-1-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 113413216 |
| Molecular Formula | C9H12N6O2S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4-amino-N-[2-(triazol-1-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | Nc1ccncc1S(=O)(=O)NCCn1ccnn1 |
| InChI | InChI=1S/C9H12N6O2S/c10-8-1-2-11-7-9(8)18(16,17)13-4-6-15-5-3-12-14-15/h1-3,5,7,13H,4,6H2,(H2,10,11) |
| InChIKey | NERHGZDYACIKOP-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |