C9H16N4O2S — CID 88944337
4-amino-N-[(propan-2-ylamino)methyl]pyridine-3-sulfonamide (PubChem CID 88944337) has the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is 4-amino-N-[(propan-2-ylamino)methyl]pyridine-3-sulfonamide.
| Compound Name | 4-amino-N-[(propan-2-ylamino)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 88944337 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-amino-N-[(propan-2-ylamino)methyl]pyridine-3-sulfonamide |
| SMILES | CC(C)NCNS(=O)(=O)c1cnccc1N |
| InChI | InChI=1S/C9H16N4O2S/c1-7(2)12-6-13-16(14,15)9-5-11-4-3-8(9)10/h3-5,7,12-13H,6H2,1-2H3,(H2,10,11) |
| InChIKey | KWRGRWVYZMFCMF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|