C9H14N4O3S — CID 142675963
1-[(4-amino-3-pyridinyl)sulfonyl]-3-propan-2-ylurea (PubChem CID 142675963) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 1-[(4-amino-3-pyridinyl)sulfonyl]-3-propan-2-ylurea.
| Compound Name | 1-[(4-amino-3-pyridinyl)sulfonyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 142675963 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-[(4-amino-3-pyridinyl)sulfonyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NS(=O)(=O)c1cnccc1N |
| InChI | InChI=1S/C9H14N4O3S/c1-6(2)12-9(14)13-17(15,16)8-5-11-4-3-7(8)10/h3-6H,1-2H3,(H2,10,11)(H2,12,13,14) |
| InChIKey | YOEICQUPAFRKGO-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |