C10H12N6O2S — CID 114389263
4-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)pyridine-3-sulfonamide (PubChem CID 114389263) has the molecular formula C10H12N6O2S and a molecular weight of 280.31 g/mol. Its IUPAC name is 4-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)pyridine-3-sulfonamide.
| Compound Name | 4-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114389263 |
| Molecular Formula | C10H12N6O2S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)pyridine-3-sulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2cnccc2N)nc1C |
| InChI | InChI=1S/C10H12N6O2S/c1-6-7(2)14-15-10(13-6)16-19(17,18)9-5-12-4-3-8(9)11/h3-5H,1-2H3,(H2,11,12)(H,13,15,16) |
| InChIKey | WWDAFHYBANKKKR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |