C11H12ClN5O2S — CID 114386803
3-amino-4-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzenesulfonamide (PubChem CID 114386803) has the molecular formula C11H12ClN5O2S and a molecular weight of 313.77 g/mol. Its IUPAC name is 3-amino-4-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzenesulfonamide.
| Compound Name | 3-amino-4-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114386803 |
| Molecular Formula | C11H12ClN5O2S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 3-amino-4-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzenesulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2ccc(Cl)c(N)c2)nc1C |
| InChI | InChI=1S/C11H12ClN5O2S/c1-6-7(2)15-16-11(14-6)17-20(18,19)8-3-4-9(12)10(13)5-8/h3-5H,13H2,1-2H3,(H,14,16,17) |
| InChIKey | MBKXRQXJXXUBBZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|