C11H11Cl2N5O2S — CID 114386798
2-amino-4,6-dichloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzenesulfonamide (PubChem CID 114386798) has the molecular formula C11H11Cl2N5O2S and a molecular weight of 348.22 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114386798 |
| Molecular Formula | C11H11Cl2N5O2S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 2-amino-4,6-dichloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzenesulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2c(N)cc(Cl)cc2Cl)nc1C |
| InChI | InChI=1S/C11H11Cl2N5O2S/c1-5-6(2)16-17-11(15-5)18-21(19,20)10-8(13)3-7(12)4-9(10)14/h3-4H,14H2,1-2H3,(H,15,17,18) |
| InChIKey | YUNTUNHFOGKHEH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|