C11H11FN4O2S — CID 104826733
N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-fluorobenzenesulfonamide (PubChem CID 104826733) has the molecular formula C11H11FN4O2S and a molecular weight of 282.30 g/mol. Its IUPAC name is N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-fluorobenzenesulfonamide.
| Compound Name | N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 104826733 |
| Molecular Formula | C11H11FN4O2S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-fluorobenzenesulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2ccc(F)cc2)nc1C |
| InChI | InChI=1S/C11H11FN4O2S/c1-7-8(2)14-15-11(13-7)16-19(17,18)10-5-3-9(12)4-6-10/h3-6H,1-2H3,(H,13,15,16) |
| InChIKey | FLFPTZNISSPNPZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |