C15H13FN2O2S2 — CID 16934102
N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-4-fluorobenzenesulfonamide (PubChem CID 16934102) has the molecular formula C15H13FN2O2S2 and a molecular weight of 336.41 g/mol. Its IUPAC name is N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-4-fluorobenzenesulfonamide.
| Compound Name | N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 16934102 |
| Molecular Formula | C15H13FN2O2S2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-4-fluorobenzenesulfonamide |
| SMILES | Cc1ccc(C)c2sc(NS(=O)(=O)c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C15H13FN2O2S2/c1-9-3-4-10(2)14-13(9)17-15(21-14)18-22(19,20)12-7-5-11(16)6-8-12/h3-8H,1-2H3,(H,17,18) |
| InChIKey | HBAYRQVPMICYJH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |