C12H13FN2O2S2 — CID 61068278
N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-4-fluorobenzenesulfonamide (PubChem CID 61068278) has the molecular formula C12H13FN2O2S2 and a molecular weight of 300.38 g/mol. Its IUPAC name is N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-4-fluorobenzenesulfonamide.
| Compound Name | N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 61068278 |
| Molecular Formula | C12H13FN2O2S2 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-4-fluorobenzenesulfonamide |
| SMILES | CCc1nc(NS(=O)(=O)c2ccc(F)cc2)sc1C |
| InChI | InChI=1S/C12H13FN2O2S2/c1-3-11-8(2)18-12(14-11)15-19(16,17)10-6-4-9(13)5-7-10/h4-7H,3H2,1-2H3,(H,14,15) |
| InChIKey | XBEKRHAOTGHOHC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |