C14H10Cl2N2O2S2 — CID 16934005
N-(4,7-dichloro-1,3-benzothiazol-2-yl)-4-methylbenzenesulfonamide (PubChem CID 16934005) has the molecular formula C14H10Cl2N2O2S2 and a molecular weight of 373.29 g/mol. Its IUPAC name is N-(4,7-dichloro-1,3-benzothiazol-2-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(4,7-dichloro-1,3-benzothiazol-2-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 16934005 |
| Molecular Formula | C14H10Cl2N2O2S2 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | N-(4,7-dichloro-1,3-benzothiazol-2-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc3c(Cl)ccc(Cl)c3s2)cc1 |
| InChI | InChI=1S/C14H10Cl2N2O2S2/c1-8-2-4-9(5-3-8)22(19,20)18-14-17-12-10(15)6-7-11(16)13(12)21-14/h2-7H,1H3,(H,17,18) |
| InChIKey | BIHFVEAVKZDWCU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |