C10H10ClN5O2S — CID 110190709
N-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-methylbenzenesulfonamide (PubChem CID 110190709) has the molecular formula C10H10ClN5O2S and a molecular weight of 299.74 g/mol. Its IUPAC name is N-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110190709 |
| Molecular Formula | C10H10ClN5O2S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | N-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc(N)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C10H10ClN5O2S/c1-6-2-4-7(5-3-6)19(17,18)16-10-14-8(11)13-9(12)15-10/h2-5H,1H3,(H3,12,13,14,15,16) |
| InChIKey | NQKGATZVKUVACA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |