C18H12Cl2N4O2S — CID 172636375
N-[4-chloro-6-(4-chlorophenyl)-5-cyanopyrimidin-2-yl]-4-methylbenzenesulfonamide (PubChem CID 172636375) has the molecular formula C18H12Cl2N4O2S and a molecular weight of 419.29 g/mol. Its IUPAC name is N-[4-chloro-6-(4-chlorophenyl)-5-cyanopyrimidin-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-chloro-6-(4-chlorophenyl)-5-cyanopyrimidin-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 172636375 |
| Molecular Formula | C18H12Cl2N4O2S |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | N-[4-chloro-6-(4-chlorophenyl)-5-cyanopyrimidin-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc(Cl)c(C#N)c(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C18H12Cl2N4O2S/c1-11-2-8-14(9-3-11)27(25,26)24-18-22-16(15(10-21)17(20)23-18)12-4-6-13(19)7-5-12/h2-9H,1H3,(H,22,23,24) |
| InChIKey | JDHXOXPVNUQXGJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |