C10H10ClN5O3S — CID 20658967
2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-5-methylbenzenesulfonic acid (PubChem CID 20658967) has the molecular formula C10H10ClN5O3S and a molecular weight of 315.74 g/mol. Its IUPAC name is 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-5-methylbenzenesulfonic acid.
| Compound Name | 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 20658967 |
| Molecular Formula | C10H10ClN5O3S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-5-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(Nc2nc(N)nc(Cl)n2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H10ClN5O3S/c1-5-2-3-6(7(4-5)20(17,18)19)13-10-15-8(11)14-9(12)16-10/h2-4H,1H3,(H,17,18,19)(H3,12,13,14,15,16) |
| InChIKey | GONNKSBHBZUQST-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|