C9H10N6O6S2 — CID 89224120
2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]benzene-1,4-disulfonic acid (PubChem CID 89224120) has the molecular formula C9H10N6O6S2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]benzene-1,4-disulfonic acid.
| Compound Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 89224120 |
| Molecular Formula | C9H10N6O6S2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]benzene-1,4-disulfonic acid |
| SMILES | Nc1nc(N)nc(Nc2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C9H10N6O6S2/c10-7-13-8(11)15-9(14-7)12-5-3-4(22(16,17)18)1-2-6(5)23(19,20)21/h1-3H,(H,16,17,18)(H,19,20,21)(H5,10,11,12,13,14,15) |
| InChIKey | VWZJLAOHPOOWLP-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 211.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|