C13H19N7O8S3 — CID 89260193
2-[[4-(dimethylamino)-6-[2-(sulfinoamino)ethylamino]-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid (PubChem CID 89260193) has the molecular formula C13H19N7O8S3 and a molecular weight of 497.54 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-6-[2-(sulfinoamino)ethylamino]-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[4-(dimethylamino)-6-[2-(sulfinoamino)ethylamino]-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 89260193 |
| Molecular Formula | C13H19N7O8S3 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 2-[[4-(dimethylamino)-6-[2-(sulfinoamino)ethylamino]-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
| SMILES | CN(C)c1nc(NCCNS(=O)O)nc(Nc2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C13H19N7O8S3/c1-20(2)13-18-11(14-5-6-15-29(21)22)17-12(19-13)16-9-7-8(30(23,24)25)3-4-10(9)31(26,27)28/h3-4,7,15H,5-6H2,1-2H3,(H,21,22)(H,23,24,25)(H,26,27,28)(H2,14,16,17,18,19) |
| InChIKey | XIYJYGNPGSWWJU-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 224.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|