C17H24N6O6S2 — CID 89007167
2-[[4-(2-ethylpiperidin-1-yl)-6-(methylamino)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid (PubChem CID 89007167) has the molecular formula C17H24N6O6S2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-[[4-(2-ethylpiperidin-1-yl)-6-(methylamino)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[4-(2-ethylpiperidin-1-yl)-6-(methylamino)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 89007167 |
| Molecular Formula | C17H24N6O6S2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-[[4-(2-ethylpiperidin-1-yl)-6-(methylamino)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
| SMILES | CCC1CCCCN1c1nc(NC)nc(Nc2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C17H24N6O6S2/c1-3-11-6-4-5-9-23(11)17-21-15(18-2)20-16(22-17)19-13-10-12(30(24,25)26)7-8-14(13)31(27,28)29/h7-8,10-11H,3-6,9H2,1-2H3,(H,24,25,26)(H,27,28,29)(H2,18,19,20,21,22) |
| InChIKey | QYARPFIRCGIRHZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 174.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|