C13H18N6O6S2 — CID 147563002
2-[[4-(dimethylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid (PubChem CID 147563002) has the molecular formula C13H18N6O6S2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[4-(dimethylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 147563002 |
| Molecular Formula | C13H18N6O6S2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2-[[4-(dimethylamino)-6-(ethylamino)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
| SMILES | CCNc1nc(Nc2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H18N6O6S2/c1-4-14-11-16-12(18-13(17-11)19(2)3)15-9-7-8(26(20,21)22)5-6-10(9)27(23,24)25/h5-7H,4H2,1-3H3,(H,20,21,22)(H,23,24,25)(H2,14,15,16,17,18) |
| InChIKey | FSZWHZQSCFWCEP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 174.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|