C15H15Cl2N9O6S2 — CID 23532450
2-[[4-chloro-6-[2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]ethylamino]-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid (PubChem CID 23532450) has the molecular formula C15H15Cl2N9O6S2 and a molecular weight of 552.38 g/mol. Its IUPAC name is 2-[[4-chloro-6-[2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]ethylamino]-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[4-chloro-6-[2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]ethylamino]-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 23532450 |
| Molecular Formula | C15H15Cl2N9O6S2 |
| Molecular Weight | 552.38 g/mol |
| Exact Mass | 551.00 |
| IUPAC Name | 2-[[4-chloro-6-[2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]ethylamino]-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
| SMILES | Cc1nc(Cl)nc(NCCNc2nc(Cl)nc(Nc3cc(S(=O)(=O)O)ccc3S(=O)(=O)O)n2)n1 |
| InChI | InChI=1S/C15H15Cl2N9O6S2/c1-7-20-11(16)23-13(21-7)18-4-5-19-14-24-12(17)25-15(26-14)22-9-6-8(33(27,28)29)2-3-10(9)34(30,31)32/h2-3,6H,4-5H2,1H3,(H,27,28,29)(H,30,31,32)(H,18,20,21,23)(H2,19,22,24,25,26) |
| InChIKey | WRLZQQXIELYELB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 222.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|