C14H17ClN6O4S — CID 59105497
4-[[4-(2-acetamidoethylamino)-6-chloro-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid (PubChem CID 59105497) has the molecular formula C14H17ClN6O4S and a molecular weight of 400.85 g/mol. Its IUPAC name is 4-[[4-(2-acetamidoethylamino)-6-chloro-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid.
| Compound Name | 4-[[4-(2-acetamidoethylamino)-6-chloro-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 59105497 |
| Molecular Formula | C14H17ClN6O4S |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 4-[[4-(2-acetamidoethylamino)-6-chloro-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid |
| SMILES | CC(=O)NCCNc1nc(Cl)nc(Nc2ccc(S(=O)(=O)O)c(C)c2)n1 |
| InChI | InChI=1S/C14H17ClN6O4S/c1-8-7-10(3-4-11(8)26(23,24)25)18-14-20-12(15)19-13(21-14)17-6-5-16-9(2)22/h3-4,7H,5-6H2,1-2H3,(H,16,22)(H,23,24,25)(H2,17,18,19,20,21) |
| InChIKey | IXPHUOQMDNFWCC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|