C14H18ClN5O9S3 — CID 20705358
4-[[4-chloro-6-[2-(2-sulfooxyethylsulfonyl)ethylamino]-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid (PubChem CID 20705358) has the molecular formula C14H18ClN5O9S3 and a molecular weight of 531.98 g/mol. Its IUPAC name is 4-[[4-chloro-6-[2-(2-sulfooxyethylsulfonyl)ethylamino]-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid.
| Compound Name | 4-[[4-chloro-6-[2-(2-sulfooxyethylsulfonyl)ethylamino]-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 20705358 |
| Molecular Formula | C14H18ClN5O9S3 |
| Molecular Weight | 531.98 g/mol |
| Exact Mass | 531.00 |
| IUPAC Name | 4-[[4-chloro-6-[2-(2-sulfooxyethylsulfonyl)ethylamino]-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid |
| SMILES | Cc1cc(Nc2nc(Cl)nc(NCCS(=O)(=O)CCOS(=O)(=O)O)n2)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C14H18ClN5O9S3/c1-9-8-10(2-3-11(9)31(23,24)25)17-14-19-12(15)18-13(20-14)16-4-6-30(21,22)7-5-29-32(26,27)28/h2-3,8H,4-7H2,1H3,(H,23,24,25)(H,26,27,28)(H2,16,17,18,19,20) |
| InChIKey | NLUJJUNTWVSUDU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 214.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.98 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|