C19H20ClN7O5S2 — CID 142234900
2-[4-[[4-[3-(carbamoylamino)-4-methylanilino]-6-chloro-1,3,5-triazin-2-yl]amino]phenyl]sulfanylethyl hydrogen sulfate (PubChem CID 142234900) has the molecular formula C19H20ClN7O5S2 and a molecular weight of 526.00 g/mol. Its IUPAC name is 2-[4-[[4-[3-(carbamoylamino)-4-methylanilino]-6-chloro-1,3,5-triazin-2-yl]amino]phenyl]sulfanylethyl hydrogen sulfate.
| Compound Name | 2-[4-[[4-[3-(carbamoylamino)-4-methylanilino]-6-chloro-1,3,5-triazin-2-yl]amino]phenyl]sulfanylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 142234900 |
| Molecular Formula | C19H20ClN7O5S2 |
| Molecular Weight | 526.00 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | 2-[4-[[4-[3-(carbamoylamino)-4-methylanilino]-6-chloro-1,3,5-triazin-2-yl]amino]phenyl]sulfanylethyl hydrogen sulfate |
| SMILES | Cc1ccc(Nc2nc(Cl)nc(Nc3ccc(SCCOS(=O)(=O)O)cc3)n2)cc1NC(N)=O |
| InChI | InChI=1S/C19H20ClN7O5S2/c1-11-2-3-13(10-15(11)24-17(21)28)23-19-26-16(20)25-18(27-19)22-12-4-6-14(7-5-12)33-9-8-32-34(29,30)31/h2-7,10H,8-9H2,1H3,(H3,21,24,28)(H,29,30,31)(H2,22,23,25,26,27) |
| InChIKey | AFOJRICJAPOVDE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 181.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.00 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|