C28H24ClN9O13S4 — CID 90368985
5-[[2-(carbamoylamino)-4-[[4-chloro-6-[2-sulfo-5-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 90368985) has the molecular formula C28H24ClN9O13S4 and a molecular weight of 858.27 g/mol. Its IUPAC name is 5-[[2-(carbamoylamino)-4-[[4-chloro-6-[2-sulfo-5-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 5-[[2-(carbamoylamino)-4-[[4-chloro-6-[2-sulfo-5-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 90368985 |
| Molecular Formula | C28H24ClN9O13S4 |
| Molecular Weight | 858.27 g/mol |
| Exact Mass | 857.01 |
| IUPAC Name | 5-[[2-(carbamoylamino)-4-[[4-chloro-6-[2-sulfo-5-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | NC(=O)Nc1cc(Nc2nc(Cl)nc(Nc3cc(S(=O)(=O)CCOS(=O)(=O)O)ccc3S(=O)(=O)O)n2)ccc1/N=N/c1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C28H24ClN9O13S4/c29-25-34-27(36-28(35-25)33-22-14-16(8-10-24(22)54(45,46)47)52(40,41)12-11-51-55(48,49)50)31-15-7-9-20(21(13-15)32-26(30)39)38-37-19-5-1-4-18-17(19)3-2-6-23(18)53(42,43)44/h1-10,13-14H,11-12H2,(H3,30,32,39)(H,42,43,44)(H,45,46,47)(H,48,49,50)(H2,31,33,34,35,36)/b38-37+ |
| InChIKey | QERAQWNHVKOOES-HEFFKOSUSA-N |
| XLogP | 4.16 |
| TPSA | 349.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|