C29H27ClN8O8S4 — CID 144686239
4-[[4-[[4-chloro-6-[5-(2-methoxysulfanyloxyethylsulfanyl)-2-sulfoanilino]-1,3,5-triazin-2-yl]amino]-2-(methylamino)phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 144686239) has the molecular formula C29H27ClN8O8S4 and a molecular weight of 779.30 g/mol. Its IUPAC name is 4-[[4-[[4-chloro-6-[5-(2-methoxysulfanyloxyethylsulfanyl)-2-sulfoanilino]-1,3,5-triazin-2-yl]amino]-2-(methylamino)phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-[[4-[[4-chloro-6-[5-(2-methoxysulfanyloxyethylsulfanyl)-2-sulfoanilino]-1,3,5-triazin-2-yl]amino]-2-(methylamino)phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 144686239 |
| Molecular Formula | C29H27ClN8O8S4 |
| Molecular Weight | 779.30 g/mol |
| Exact Mass | 778.05 |
| IUPAC Name | 4-[[4-[[4-chloro-6-[5-(2-methoxysulfanyloxyethylsulfanyl)-2-sulfoanilino]-1,3,5-triazin-2-yl]amino]-2-(methylamino)phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | CNc1cc(Nc2nc(Cl)nc(Nc3cc(SCCOSOC)ccc3S(=O)(=O)O)n2)ccc1/N=N/c1ccc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C29H27ClN8O8S4/c1-31-23-15-17(7-9-22(23)38-37-21-10-12-25(49(39,40)41)20-6-4-3-5-19(20)21)32-28-34-27(30)35-29(36-28)33-24-16-18(47-14-13-46-48-45-2)8-11-26(24)50(42,43)44/h3-12,15-16,31H,13-14H2,1-2H3,(H,39,40,41)(H,42,43,44)(H2,32,33,34,35,36)/b38-37+ |
| InChIKey | UVPQJNGABYXASD-HEFFKOSUSA-N |
| XLogP | 7.43 |
| TPSA | 226.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.30 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|