C27H21ClN8O13S4 — CID 132582656
3-[[2-acetamido-4-[[4-chloro-6-(2,5-disulfoanilino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 132582656) has the molecular formula C27H21ClN8O13S4 and a molecular weight of 829.23 g/mol. Its IUPAC name is 3-[[2-acetamido-4-[[4-chloro-6-(2,5-disulfoanilino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[2-acetamido-4-[[4-chloro-6-(2,5-disulfoanilino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 132582656 |
| Molecular Formula | C27H21ClN8O13S4 |
| Molecular Weight | 829.23 g/mol |
| Exact Mass | 827.98 |
| IUPAC Name | 3-[[2-acetamido-4-[[4-chloro-6-(2,5-disulfoanilino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | CC(=O)Nc1cc(Nc2nc(Cl)nc(Nc3cc(S(=O)(=O)O)ccc3S(=O)(=O)O)n2)ccc1/N=N/c1cc(S(=O)(=O)O)c2cccc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C27H21ClN8O13S4/c1-13(37)29-20-10-14(30-26-32-25(28)33-27(34-26)31-21-12-16(50(38,39)40)6-8-23(21)52(44,45)46)5-7-19(20)36-35-15-9-18-17(24(11-15)53(47,48)49)3-2-4-22(18)51(41,42)43/h2-12H,1H3,(H,29,37)(H,38,39,40)(H,41,42,43)(H,44,45,46)(H,47,48,49)(H2,30,31,32,33,34)/b36-35+ |
| InChIKey | ZPIWBISOIPEELU-ULDVOPSXSA-N |
| XLogP | 4.53 |
| TPSA | 334.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.23 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|