C23H21N7O7S2 — CID 20677974
3-[[2-acetamido-4-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 20677974) has the molecular formula C23H21N7O7S2 and a molecular weight of 571.60 g/mol. Its IUPAC name is 3-[[2-acetamido-4-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[2-acetamido-4-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 20677974 |
| Molecular Formula | C23H21N7O7S2 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | 3-[[2-acetamido-4-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | CC(=O)Nc1cc(Nc2nc(C)nc(C)n2)ccc1/N=N/c1cc(S(=O)(=O)O)c2cccc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C23H21N7O7S2/c1-12-24-13(2)26-23(25-12)28-15-7-8-19(20(10-15)27-14(3)31)30-29-16-9-18-17(22(11-16)39(35,36)37)5-4-6-21(18)38(32,33)34/h4-11H,1-3H3,(H,27,31)(H,32,33,34)(H,35,36,37)(H,24,25,26,28)/b30-29+ |
| InChIKey | PARMEZDLTMXRAM-QVIHXGFCSA-N |
| XLogP | 4.25 |
| TPSA | 213.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|