C18H17N3O6S2 — CID 21351279
3-[[2-methyl-4-(methylamino)phenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 21351279) has the molecular formula C18H17N3O6S2 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-[[2-methyl-4-(methylamino)phenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[2-methyl-4-(methylamino)phenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 21351279 |
| Molecular Formula | C18H17N3O6S2 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 3-[[2-methyl-4-(methylamino)phenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | CNc1ccc(/N=N/c2cc(S(=O)(=O)O)c3cccc(S(=O)(=O)O)c3c2)c(C)c1 |
| InChI | InChI=1S/C18H17N3O6S2/c1-11-8-12(19-2)6-7-16(11)21-20-13-9-15-14(18(10-13)29(25,26)27)4-3-5-17(15)28(22,23)24/h3-10,19H,1-2H3,(H,22,23,24)(H,25,26,27)/b21-20+ |
| InChIKey | DRBMYTIADBOKAT-QZQOTICOSA-N |
| XLogP | 4.10 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|