C27H21N5O12S4 — CID 158495842
3-[[4-[(4-amino-2-methylphenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]naphthalene-1,5-disulfonic acid;sulfur trioxide (PubChem CID 158495842) has the molecular formula C27H21N5O12S4 and a molecular weight of 735.76 g/mol. Its IUPAC name is 3-[[4-[(4-amino-2-methylphenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]naphthalene-1,5-disulfonic acid;sulfur trioxide.
| Compound Name | 3-[[4-[(4-amino-2-methylphenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]naphthalene-1,5-disulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 158495842 |
| Molecular Formula | C27H21N5O12S4 |
| Molecular Weight | 735.76 g/mol |
| Exact Mass | 735.01 |
| IUPAC Name | 3-[[4-[(4-amino-2-methylphenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]naphthalene-1,5-disulfonic acid;sulfur trioxide |
| SMILES | Cc1cc(N)ccc1/N=N/c1ccc(/N=N/c2cc(S(=O)(=O)O)c3cccc(S(=O)(=O)O)c3c2)c2cc(S(=O)(=O)O)ccc12.O=S(=O)=O |
| InChI | InChI=1S/C27H21N5O9S3.O3S/c1-15-11-16(28)5-8-23(15)30-32-24-9-10-25(21-14-18(42(33,34)35)6-7-19(21)24)31-29-17-12-22-20(27(13-17)44(39,40)41)3-2-4-26(22)43(36,37)38;1-4(2)3/h2-14H,28H2,1H3,(H,33,34,35)(H,36,37,38)(H,39,40,41);/b31-29+,32-30+; |
| InChIKey | HJGVNMIREHMXDP-JPGNHJAOSA-N |
| XLogP | 5.45 |
| TPSA | 289.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.76 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|