C30H26N4O6S2 — CID 18343815
3-[[4-[(2,4-dimethylphenyl)diazenyl]-7-methylnaphthalen-1-yl]diazenyl]-7-methylnaphthalene-1,5-disulfonic acid (PubChem CID 18343815) has the molecular formula C30H26N4O6S2 and a molecular weight of 602.69 g/mol. Its IUPAC name is 3-[[4-[(2,4-dimethylphenyl)diazenyl]-7-methylnaphthalen-1-yl]diazenyl]-7-methylnaphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[4-[(2,4-dimethylphenyl)diazenyl]-7-methylnaphthalen-1-yl]diazenyl]-7-methylnaphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 18343815 |
| Molecular Formula | C30H26N4O6S2 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | 3-[[4-[(2,4-dimethylphenyl)diazenyl]-7-methylnaphthalen-1-yl]diazenyl]-7-methylnaphthalene-1,5-disulfonic acid |
| SMILES | Cc1ccc(/N=N/c2ccc(/N=N/c3cc(S(=O)(=O)O)c4cc(C)cc(S(=O)(=O)O)c4c3)c3cc(C)ccc23)c(C)c1 |
| InChI | InChI=1S/C30H26N4O6S2/c1-17-6-8-26(20(4)11-17)32-34-27-9-10-28(23-12-18(2)5-7-22(23)27)33-31-21-15-25-24(30(16-21)42(38,39)40)13-19(3)14-29(25)41(35,36)37/h5-16H,1-4H3,(H,35,36,37)(H,38,39,40)/b33-31+,34-32+ |
| InChIKey | QXDONSIGLFUPPA-FMWAKIAMSA-N |
| XLogP | 8.55 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|