C23H18N4O9S3 — CID 89345714
2-[[4-[(4-methylphenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]benzene-1,4-disulfonic acid (PubChem CID 89345714) has the molecular formula C23H18N4O9S3 and a molecular weight of 590.62 g/mol. Its IUPAC name is 2-[[4-[(4-methylphenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[4-[(4-methylphenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 89345714 |
| Molecular Formula | C23H18N4O9S3 |
| Molecular Weight | 590.62 g/mol |
| Exact Mass | 590.02 |
| IUPAC Name | 2-[[4-[(4-methylphenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]benzene-1,4-disulfonic acid |
| SMILES | Cc1ccc(/N=N/c2ccc(/N=N/c3cc(S(=O)(=O)O)ccc3S(=O)(=O)O)c3cc(S(=O)(=O)O)ccc23)cc1 |
| InChI | InChI=1S/C23H18N4O9S3/c1-14-2-4-15(5-3-14)24-25-20-9-10-21(19-12-16(37(28,29)30)6-8-18(19)20)26-27-22-13-17(38(31,32)33)7-11-23(22)39(34,35)36/h2-13H,1H3,(H,28,29,30)(H,31,32,33)(H,34,35,36)/b25-24+,27-26+ |
| InChIKey | BGSCATZFYIELKR-JQRDNDPDSA-N |
| XLogP | 5.72 |
| TPSA | 212.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|