C24H20N4O4S — CID 20569284
5-[(2-methoxy-5-methylphenyl)diazenyl]-8-phenyldiazenylnaphthalene-2-sulfonic acid (PubChem CID 20569284) has the molecular formula C24H20N4O4S and a molecular weight of 460.52 g/mol. Its IUPAC name is 5-[(2-methoxy-5-methylphenyl)diazenyl]-8-phenyldiazenylnaphthalene-2-sulfonic acid.
| Compound Name | 5-[(2-methoxy-5-methylphenyl)diazenyl]-8-phenyldiazenylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 20569284 |
| Molecular Formula | C24H20N4O4S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 5-[(2-methoxy-5-methylphenyl)diazenyl]-8-phenyldiazenylnaphthalene-2-sulfonic acid |
| SMILES | COc1ccc(C)cc1/N=N/c1ccc(/N=N/c2ccccc2)c2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C24H20N4O4S/c1-16-8-13-24(32-2)23(14-16)28-27-21-11-12-22(26-25-17-6-4-3-5-7-17)20-15-18(33(29,30)31)9-10-19(20)21/h3-15H,1-2H3,(H,29,30,31)/b26-25+,28-27+ |
| InChIKey | KUADTRRWQZKYMG-PAMTUDGESA-N |
| XLogP | 7.23 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|