C21H20N4NaO6S — CID 170841645
CID 170841645 (PubChem CID 170841645) has the molecular formula C21H20N4NaO6S and a molecular weight of 479.47 g/mol.
| Compound Name | CID 170841645 |
|---|---|
| PubChem CID | 170841645 |
| Molecular Formula | C21H20N4NaO6S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | — |
| SMILES | COc1cc(/N=N/c2cc(S(=O)(=O)O)ccc2OC)c(C)cc1/N=N/c1ccc(O)cc1.[Na] |
| InChI | InChI=1S/C21H20N4O6S.Na/c1-13-10-18(24-22-14-4-6-15(26)7-5-14)21(31-3)12-17(13)23-25-19-11-16(32(27,28)29)8-9-20(19)30-2;/h4-12,26H,1-3H3,(H,27,28,29);/b24-22+,25-23+; |
| InChIKey | VIJPVCXBBQXLBG-ZDWKHXMKSA-N |
| XLogP | 5.41 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|