C14H13N2NaO4S — CID 101119897
sodium 4,5-dimethyl-2-[(4-sulfophenyl)diazenyl]phenolate (PubChem CID 101119897) has the molecular formula C14H13N2NaO4S and a molecular weight of 328.33 g/mol. Its IUPAC name is sodium 4,5-dimethyl-2-[(4-sulfophenyl)diazenyl]phenolate.
| Compound Name | sodium 4,5-dimethyl-2-[(4-sulfophenyl)diazenyl]phenolate |
|---|---|
| PubChem CID | 101119897 |
| Molecular Formula | C14H13N2NaO4S |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | sodium 4,5-dimethyl-2-[(4-sulfophenyl)diazenyl]phenolate |
| SMILES | Cc1cc([O-])c(/N=N/c2ccc(S(=O)(=O)O)cc2)cc1C.[Na+] |
| InChI | InChI=1S/C14H14N2O4S.Na/c1-9-7-13(14(17)8-10(9)2)16-15-11-3-5-12(6-4-11)21(18,19)20;/h3-8,17H,1-2H3,(H,18,19,20);/q;+1/p-1/b16-15+; |
| InChIKey | IWNKJYSWPRYMLW-GEEYTBSJSA-M |
| XLogP | 0.04 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|