C14H15N3NaO3S+ — CID 54609884
sodium 4-[(4-amino-2-methylphenyl)diazenyl]-3-methylbenzenesulfonic acid (PubChem CID 54609884) has the molecular formula C14H15N3NaO3S+ and a molecular weight of 328.35 g/mol. Its IUPAC name is sodium 4-[(4-amino-2-methylphenyl)diazenyl]-3-methylbenzenesulfonic acid.
| Compound Name | sodium 4-[(4-amino-2-methylphenyl)diazenyl]-3-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 54609884 |
| Molecular Formula | C14H15N3NaO3S+ |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | sodium 4-[(4-amino-2-methylphenyl)diazenyl]-3-methylbenzenesulfonic acid |
| SMILES | Cc1cc(N)ccc1/N=N/c1ccc(S(=O)(=O)O)cc1C.[Na+] |
| InChI | InChI=1S/C14H15N3O3S.Na/c1-9-7-11(15)3-5-13(9)16-17-14-6-4-12(8-10(14)2)21(18,19)20;/h3-8H,15H2,1-2H3,(H,18,19,20);/q;+1/b17-16+; |
| InChIKey | RSPKQQSDVVKWSC-CMBBICFISA-N |
| XLogP | 0.55 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|