C15H16N2O6S2 — CID 20741785
4-[(4-ethyl-2-methylphenyl)diazenyl]benzene-1,3-disulfonic acid (PubChem CID 20741785) has the molecular formula C15H16N2O6S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-[(4-ethyl-2-methylphenyl)diazenyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[(4-ethyl-2-methylphenyl)diazenyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 20741785 |
| Molecular Formula | C15H16N2O6S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 4-[(4-ethyl-2-methylphenyl)diazenyl]benzene-1,3-disulfonic acid |
| SMILES | CCc1ccc(/N=N/c2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)c(C)c1 |
| InChI | InChI=1S/C15H16N2O6S2/c1-3-11-4-6-13(10(2)8-11)16-17-14-7-5-12(24(18,19)20)9-15(14)25(21,22)23/h4-9H,3H2,1-2H3,(H,18,19,20)(H,21,22,23)/b17-16+ |
| InChIKey | PFKHVUVZFIPINB-WUKNDPDISA-N |
| XLogP | 3.47 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|