C23H19N5O6S2 — CID 54234900
5-[(4-amino-2-methylphenyl)diazenyl]-8-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 54234900) has the molecular formula C23H19N5O6S2 and a molecular weight of 525.57 g/mol. Its IUPAC name is 5-[(4-amino-2-methylphenyl)diazenyl]-8-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 5-[(4-amino-2-methylphenyl)diazenyl]-8-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 54234900 |
| Molecular Formula | C23H19N5O6S2 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 5-[(4-amino-2-methylphenyl)diazenyl]-8-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1cc(N)ccc1/N=N/c1ccc(/N=N/c2ccccc2S(=O)(=O)O)c2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C23H19N5O6S2/c1-14-12-15(24)6-9-19(14)25-26-20-10-11-21(18-13-16(35(29,30)31)7-8-17(18)20)27-28-22-4-2-3-5-23(22)36(32,33)34/h2-13H,24H2,1H3,(H,29,30,31)(H,32,33,34)/b26-25+,28-27+ |
| InChIKey | QLVSCTFUHQWOMQ-PAMTUDGESA-N |
| XLogP | 6.05 |
| TPSA | 184.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|