C13H14N4O3S — CID 20764501
4-[(2,4-diaminophenyl)diazenyl]-3-methylbenzenesulfonic acid (PubChem CID 20764501) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is 4-[(2,4-diaminophenyl)diazenyl]-3-methylbenzenesulfonic acid.
| Compound Name | 4-[(2,4-diaminophenyl)diazenyl]-3-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 20764501 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-[(2,4-diaminophenyl)diazenyl]-3-methylbenzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)ccc1/N=N/c1ccc(N)cc1N |
| InChI | InChI=1S/C13H14N4O3S/c1-8-6-10(21(18,19)20)3-5-12(8)16-17-13-4-2-9(14)7-11(13)15/h2-7H,14-15H2,1H3,(H,18,19,20)/b17-16+ |
| InChIKey | PZALHOIDAJLEPZ-WUKNDPDISA-N |
| XLogP | 2.82 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|