C12H12N4O3S — CID 20764494
3-[(2,4-diaminophenyl)diazenyl]benzenesulfonic acid (PubChem CID 20764494) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-[(2,4-diaminophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 3-[(2,4-diaminophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 20764494 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 3-[(2,4-diaminophenyl)diazenyl]benzenesulfonic acid |
| SMILES | Nc1ccc(/N=N/c2cccc(S(=O)(=O)O)c2)c(N)c1 |
| InChI | InChI=1S/C12H12N4O3S/c13-8-4-5-12(11(14)6-8)16-15-9-2-1-3-10(7-9)20(17,18)19/h1-7H,13-14H2,(H,17,18,19)/b16-15+ |
| InChIKey | IJCCXHXFXRFAGR-FOCLMDBBSA-N |
| XLogP | 2.51 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|