C13H11N3O5S — CID 22706692
2-amino-5-[(3-sulfophenyl)diazenyl]benzoic acid (PubChem CID 22706692) has the molecular formula C13H11N3O5S and a molecular weight of 321.31 g/mol. Its IUPAC name is 2-amino-5-[(3-sulfophenyl)diazenyl]benzoic acid.
| Compound Name | 2-amino-5-[(3-sulfophenyl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 22706692 |
| Molecular Formula | C13H11N3O5S |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-amino-5-[(3-sulfophenyl)diazenyl]benzoic acid |
| SMILES | Nc1ccc(/N=N/c2cccc(S(=O)(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C13H11N3O5S/c14-12-5-4-9(7-11(12)13(17)18)16-15-8-2-1-3-10(6-8)22(19,20)21/h1-7H,14H2,(H,17,18)(H,19,20,21)/b16-15+ |
| InChIKey | JDCOHTLQKTZOCC-FOCLMDBBSA-N |
| XLogP | 2.63 |
| TPSA | 142.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|