C26H20N6Na2O7S — CID 170844913
CID 170844913 (PubChem CID 170844913) has the molecular formula C26H20N6Na2O7S and a molecular weight of 606.53 g/mol.
| Compound Name | CID 170844913 |
|---|---|
| PubChem CID | 170844913 |
| Molecular Formula | C26H20N6Na2O7S |
| Molecular Weight | 606.53 g/mol |
| Exact Mass | 606.09 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ccc(/N=N/c2cccc(S(=O)(=O)O)c2)cc1)Nc1ccc(/N=N/c2ccc(O)c(C(=O)O)c2)cc1.[Na].[Na] |
| InChI | InChI=1S/C26H20N6O7S.2Na/c33-24-13-12-21(15-23(24)25(34)35)32-30-19-10-6-17(7-11-19)28-26(36)27-16-4-8-18(9-5-16)29-31-20-2-1-3-22(14-20)40(37,38)39;;/h1-15,33H,(H,34,35)(H2,27,28,36)(H,37,38,39);;/b31-29+,32-30+;; |
| InChIKey | SSOXJVPGOKFZEU-FBYWTXOISA-N |
| XLogP | 6.05 |
| TPSA | 202.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|