C26H20N6O7S — CID 153494430
3-[[4-[[4-[(3-formyloxy-4-hydroxyphenyl)diazenyl]phenyl]carbamoylamino]phenyl]diazenyl]benzenesulfonic acid (PubChem CID 153494430) has the molecular formula C26H20N6O7S and a molecular weight of 560.55 g/mol. Its IUPAC name is 3-[[4-[[4-[(3-formyloxy-4-hydroxyphenyl)diazenyl]phenyl]carbamoylamino]phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 3-[[4-[[4-[(3-formyloxy-4-hydroxyphenyl)diazenyl]phenyl]carbamoylamino]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 153494430 |
| Molecular Formula | C26H20N6O7S |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | 3-[[4-[[4-[(3-formyloxy-4-hydroxyphenyl)diazenyl]phenyl]carbamoylamino]phenyl]diazenyl]benzenesulfonic acid |
| SMILES | O=COc1cc(/N=N/c2ccc(NC(=O)Nc3ccc(/N=N/c4cccc(S(=O)(=O)O)c4)cc3)cc2)ccc1O |
| InChI | InChI=1S/C26H20N6O7S/c33-16-39-25-15-22(12-13-24(25)34)32-30-20-10-6-18(7-11-20)28-26(35)27-17-4-8-19(9-5-17)29-31-21-2-1-3-23(14-21)40(36,37)38/h1-16,34H,(H2,27,28,35)(H,36,37,38)/b31-29+,32-30+ |
| InChIKey | ZWIGWKHFFKUEMG-JWTBXLROSA-N |
| XLogP | 6.65 |
| TPSA | 191.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|