C27H20K2N6O7 — CID 170854418
CID 170854418 (PubChem CID 170854418) has the molecular formula C27H20K2N6O7 and a molecular weight of 618.69 g/mol.
| Compound Name | CID 170854418 |
|---|---|
| PubChem CID | 170854418 |
| Molecular Formula | C27H20K2N6O7 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.07 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ccc(/N=N/c2ccc(O)c(C(=O)O)c2)cc1)Nc1ccc(/N=N/c2ccc(O)c(C(=O)O)c2)cc1.[K].[K] |
| InChI | InChI=1S/C27H20N6O7.2K/c34-23-11-9-19(13-21(23)25(36)37)32-30-17-5-1-15(2-6-17)28-27(40)29-16-3-7-18(8-4-16)31-33-20-10-12-24(35)22(14-20)26(38)39;;/h1-14,34-35H,(H,36,37)(H,38,39)(H2,28,29,40);;/b32-30+,33-31+;; |
| InChIKey | KJSABYKDDLBXTB-WKLYGGTQSA-N |
| XLogP | 6.21 |
| TPSA | 205.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|