C17H16N3NaO6 — CID 173281834
sodium;5-[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid;hydride (PubChem CID 173281834) has the molecular formula C17H16N3NaO6 and a molecular weight of 381.32 g/mol. Its IUPAC name is sodium;5-[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid;hydride.
| Compound Name | sodium;5-[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid;hydride |
|---|---|
| PubChem CID | 173281834 |
| Molecular Formula | C17H16N3NaO6 |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | sodium;5-[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid;hydride |
| SMILES | O=C(O)CCNC(=O)c1ccc(/N=N/c2ccc(O)c(C(=O)O)c2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C17H15N3O6.Na.H/c21-14-6-5-12(9-13(14)17(25)26)20-19-11-3-1-10(2-4-11)16(24)18-8-7-15(22)23;;/h1-6,9,21H,7-8H2,(H,18,24)(H,22,23)(H,25,26);;/q;+1;-1/b20-19+;; |
| InChIKey | ATGHWTHNAWSHRU-LLIZZRELSA-N |
| XLogP | -0.17 |
| TPSA | 148.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|