C17H13N3Na2O6 — CID 154824777
disodium;5-[[3-(2-carboxylatoethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoate (PubChem CID 154824777) has the molecular formula C17H13N3Na2O6 and a molecular weight of 401.29 g/mol. Its IUPAC name is disodium;5-[[3-(2-carboxylatoethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoate.
| Compound Name | disodium;5-[[3-(2-carboxylatoethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 154824777 |
| Molecular Formula | C17H13N3Na2O6 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | disodium;5-[[3-(2-carboxylatoethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoate |
| SMILES | O=C([O-])CCNC(=O)c1cccc(/N=N/c2ccc(O)c(C(=O)[O-])c2)c1.[Na+].[Na+] |
| InChI | InChI=1S/C17H15N3O6.2Na/c21-14-5-4-12(9-13(14)17(25)26)20-19-11-3-1-2-10(8-11)16(24)18-7-6-15(22)23;;/h1-5,8-9,21H,6-7H2,(H,18,24)(H,22,23)(H,25,26);;/q;2*+1/p-2/b20-19+;; |
| InChIKey | QNMYOKUDHBREEJ-LLIZZRELSA-L |
| XLogP | -5.95 |
| TPSA | 154.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | -5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|