C16H14N3NaO5 — CID 135773251
sodium 2-hydroxy-5-[[4-(1-hydroxyethylcarbamoyl)phenyl]diazenyl]benzoate (PubChem CID 135773251) has the molecular formula C16H14N3NaO5 and a molecular weight of 351.29 g/mol. Its IUPAC name is sodium 2-hydroxy-5-[[4-(1-hydroxyethylcarbamoyl)phenyl]diazenyl]benzoate.
| Compound Name | sodium 2-hydroxy-5-[[4-(1-hydroxyethylcarbamoyl)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 135773251 |
| Molecular Formula | C16H14N3NaO5 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | sodium 2-hydroxy-5-[[4-(1-hydroxyethylcarbamoyl)phenyl]diazenyl]benzoate |
| SMILES | CC(O)NC(=O)c1ccc(/N=N/c2ccc(O)c(C(=O)[O-])c2)cc1.[Na+] |
| InChI | InChI=1S/C16H15N3O5.Na/c1-9(20)17-15(22)10-2-4-11(5-3-10)18-19-12-6-7-14(21)13(8-12)16(23)24;/h2-9,20-21H,1H3,(H,17,22)(H,23,24);/q;+1/p-1/b19-18+; |
| InChIKey | IRKUYLLNNVUNBM-LTRPLHCISA-M |
| XLogP | -1.76 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|