About sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid
sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid (PubChem CID 173234784) has the molecular formula C13H10N3NaO5
and a molecular weight of 311.23 g/mol. Its IUPAC name is sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid.
Molecular Properties
| Compound Name | sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid |
| PubChem CID | 173234784 |
| Molecular Formula | C13H10N3NaO5 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid |
| SMILES | O=C(O)c1cc(/N=N/c2ccc([N+](=O)[O-])cc2)ccc1O.[H-].[Na+] |
| InChI | InChI=1S/C13H9N3O5.Na.H/c17-12-6-3-9(7-11(12)13(18)19)15-14-8-1-4-10(5-2-8)16(20)21;;/h1-7,17H,(H,18,19);;/q;+1;-1/b15-14+;; |
| InChIKey | BFGZAAOSSZYMMV-NSKUCRDLSA-N |
| XLogP | 0.53 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid?
The IUPAC name of sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid (CID 173234784) is sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid.
What is the SMILES notation for sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid?
The canonical SMILES for sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid is O=C(O)c1cc(/N=N/c2ccc([N+](=O)[O-])cc2)ccc1O.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid?
The InChIKey is BFGZAAOSSZYMMV-NSKUCRDLSA-N. The full InChI is InChI=1S/C13H9N3O5.Na.H/c17-12-6-3-9(7-11(12)13(18)19)15-14-8-1-4-10(5-2-8)16(20)21;;/h1-7,17H,(H,18,19);;/q;+1;-1/b15-14+;;.
What are the key properties of sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid?
sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid has a molecular weight of 311.23 g/mol, XLogP of 0.53, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid is sourced from PubChem (CID 173234784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).