C12H7Br2N3O3 — CID 135612765
2,6-dibromo-4-[(4-nitrophenyl)diazenyl]phenol (PubChem CID 135612765) has the molecular formula C12H7Br2N3O3 and a molecular weight of 401.01 g/mol. Its IUPAC name is 2,6-dibromo-4-[(4-nitrophenyl)diazenyl]phenol.
| Compound Name | 2,6-dibromo-4-[(4-nitrophenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 135612765 |
| Molecular Formula | C12H7Br2N3O3 |
| Molecular Weight | 401.01 g/mol |
| Exact Mass | 398.89 |
| IUPAC Name | 2,6-dibromo-4-[(4-nitrophenyl)diazenyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2cc(Br)c(O)c(Br)c2)cc1 |
| InChI | InChI=1S/C12H7Br2N3O3/c13-10-5-8(6-11(14)12(10)18)16-15-7-1-3-9(4-2-7)17(19)20/h1-6,18H/b16-15+ |
| InChIKey | LGSLCBLDMDBWHB-FOCLMDBBSA-N |
| XLogP | 5.24 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.01 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|