C12H6Cl3N3O3 — CID 136695318
3,4,6-trichloro-2-[(4-nitrophenyl)diazenyl]phenol (PubChem CID 136695318) has the molecular formula C12H6Cl3N3O3 and a molecular weight of 346.56 g/mol. Its IUPAC name is 3,4,6-trichloro-2-[(4-nitrophenyl)diazenyl]phenol.
| Compound Name | 3,4,6-trichloro-2-[(4-nitrophenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 136695318 |
| Molecular Formula | C12H6Cl3N3O3 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 3,4,6-trichloro-2-[(4-nitrophenyl)diazenyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2c(O)c(Cl)cc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C12H6Cl3N3O3/c13-8-5-9(14)12(19)11(10(8)15)17-16-6-1-3-7(4-2-6)18(20)21/h1-5,19H/b17-16+ |
| InChIKey | VLNFRHZZRYMQAK-WUKNDPDISA-N |
| XLogP | 5.68 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|